C28H15ClN2S2 — CID 135383460
2-chloro-4,6-di(dibenzothiophen-3-yl)pyrimidine (PubChem CID 135383460) has the molecular formula C28H15ClN2S2 and a molecular weight of 479.03 g/mol. Its IUPAC name is 2-chloro-4,6-di(dibenzothiophen-3-yl)pyrimidine.
| Compound Name | 2-chloro-4,6-di(dibenzothiophen-3-yl)pyrimidine |
|---|---|
| PubChem CID | 135383460 |
| Molecular Formula | C28H15ClN2S2 |
| Molecular Weight | 479.03 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | 2-chloro-4,6-di(dibenzothiophen-3-yl)pyrimidine |
| SMILES | Clc1nc(-c2ccc3c(c2)sc2ccccc23)cc(-c2ccc3c(c2)sc2ccccc23)n1 |
| InChI | InChI=1S/C28H15ClN2S2/c29-28-30-22(16-9-11-20-18-5-1-3-7-24(18)32-26(20)13-16)15-23(31-28)17-10-12-21-19-6-2-4-8-25(19)33-27(21)14-17/h1-15H |
| InChIKey | NXIJXSGBDSJTDZ-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.03 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |