C11H18FN3O2 — CID 145443363
ethane;1-(3-ethyl-5-fluoro-4-pyridinyl)-3-methoxyurea (PubChem CID 145443363) has the molecular formula C11H18FN3O2 and a molecular weight of 243.28 g/mol. Its IUPAC name is ethane;1-(3-ethyl-5-fluoro-4-pyridinyl)-3-methoxyurea.
| Compound Name | ethane;1-(3-ethyl-5-fluoro-4-pyridinyl)-3-methoxyurea |
|---|---|
| PubChem CID | 145443363 |
| Molecular Formula | C11H18FN3O2 |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | ethane;1-(3-ethyl-5-fluoro-4-pyridinyl)-3-methoxyurea |
| SMILES | CC.CCc1cncc(F)c1NC(=O)NOC |
| InChI | InChI=1S/C9H12FN3O2.C2H6/c1-3-6-4-11-5-7(10)8(6)12-9(14)13-15-2;1-2/h4-5H,3H2,1-2H3,(H2,11,12,13,14);1-2H3 |
| InChIKey | DYSXNRNFTGODGK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|