C12H13FN2O3S — CID 145446179
4-(4-fluorophenyl)sulfonyl-2-azabicyclo[2.1.1]hexane-3-carboxamide (PubChem CID 145446179) has the molecular formula C12H13FN2O3S and a molecular weight of 284.31 g/mol. Its IUPAC name is 4-(4-fluorophenyl)sulfonyl-2-azabicyclo[2.1.1]hexane-3-carboxamide.
| Compound Name | 4-(4-fluorophenyl)sulfonyl-2-azabicyclo[2.1.1]hexane-3-carboxamide |
|---|---|
| PubChem CID | 145446179 |
| Molecular Formula | C12H13FN2O3S |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 4-(4-fluorophenyl)sulfonyl-2-azabicyclo[2.1.1]hexane-3-carboxamide |
| SMILES | NC(=O)C1NC2CC1(S(=O)(=O)c1ccc(F)cc1)C2 |
| InChI | InChI=1S/C12H13FN2O3S/c13-7-1-3-9(4-2-7)19(17,18)12-5-8(6-12)15-10(12)11(14)16/h1-4,8,10,15H,5-6H2,(H2,14,16) |
| InChIKey | YPRBJUMZWWRQKI-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |