C13H15FN2O3S — CID 141441772
1-(4-fluorophenyl)sulfonyl-2-azabicyclo[2.2.1]heptane-3-carboxamide (PubChem CID 141441772) has the molecular formula C13H15FN2O3S and a molecular weight of 298.34 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-2-azabicyclo[2.2.1]heptane-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-2-azabicyclo[2.2.1]heptane-3-carboxamide |
|---|---|
| PubChem CID | 141441772 |
| Molecular Formula | C13H15FN2O3S |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-2-azabicyclo[2.2.1]heptane-3-carboxamide |
| SMILES | NC(=O)C1NC2(S(=O)(=O)c3ccc(F)cc3)CCC1C2 |
| InChI | InChI=1S/C13H15FN2O3S/c14-9-1-3-10(4-2-9)20(18,19)13-6-5-8(7-13)11(16-13)12(15)17/h1-4,8,11,16H,5-7H2,(H2,15,17) |
| InChIKey | BUSOMOSUFZLZEV-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |