C21H20N4O2 — CID 145446375
tert-butyl 11-(2-methyl-4-pyridinyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8-carboxylate (PubChem CID 145446375) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is tert-butyl 11-(2-methyl-4-pyridinyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8-carboxylate.
| Compound Name | tert-butyl 11-(2-methyl-4-pyridinyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8-carboxylate |
|---|---|
| PubChem CID | 145446375 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | tert-butyl 11-(2-methyl-4-pyridinyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8-carboxylate |
| SMILES | Cc1cc(-c2ccc3c4cnccc4n(C(=O)OC(C)(C)C)c3n2)ccn1 |
| InChI | InChI=1S/C21H20N4O2/c1-13-11-14(7-10-23-13)17-6-5-15-16-12-22-9-8-18(16)25(19(15)24-17)20(26)27-21(2,3)4/h5-12H,1-4H3 |
| InChIKey | XRKFKAJYTDKYAS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |