C23H26N5O2+ — CID 153328709
trimethyl-[4-[8-[(2-methylpropan-2-yl)oxycarbonyl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]-2-pyridinyl]azanium (PubChem CID 153328709) has the molecular formula C23H26N5O2+ and a molecular weight of 404.49 g/mol. Its IUPAC name is trimethyl-[4-[8-[(2-methylpropan-2-yl)oxycarbonyl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]-2-pyridinyl]azanium.
| Compound Name | trimethyl-[4-[8-[(2-methylpropan-2-yl)oxycarbonyl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]-2-pyridinyl]azanium |
|---|---|
| PubChem CID | 153328709 |
| Molecular Formula | C23H26N5O2+ |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | trimethyl-[4-[8-[(2-methylpropan-2-yl)oxycarbonyl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]-2-pyridinyl]azanium |
| SMILES | CC(C)(C)OC(=O)n1c2ccncc2c2ccc(-c3ccnc([N+](C)(C)C)c3)nc21 |
| InChI | InChI=1S/C23H26N5O2/c1-23(2,3)30-22(29)27-19-10-11-24-14-17(19)16-7-8-18(26-21(16)27)15-9-12-25-20(13-15)28(4,5)6/h7-14H,1-6H3/q+1 |
| InChIKey | XQDOKHHPQQROLU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|