C20H17N5O4 — CID 145446395
tert-butyl 11-(4-nitro-2-pyridinyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8-carboxylate (PubChem CID 145446395) has the molecular formula C20H17N5O4 and a molecular weight of 391.39 g/mol. Its IUPAC name is tert-butyl 11-(4-nitro-2-pyridinyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8-carboxylate.
| Compound Name | tert-butyl 11-(4-nitro-2-pyridinyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8-carboxylate |
|---|---|
| PubChem CID | 145446395 |
| Molecular Formula | C20H17N5O4 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | tert-butyl 11-(4-nitro-2-pyridinyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c2ccncc2c2ccc(-c3cc([N+](=O)[O-])ccn3)nc21 |
| InChI | InChI=1S/C20H17N5O4/c1-20(2,3)29-19(26)24-17-7-8-21-11-14(17)13-4-5-15(23-18(13)24)16-10-12(25(27)28)6-9-22-16/h4-11H,1-3H3 |
| InChIKey | ZSHPWPWQXBGVLU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|