C21H22N6O5S — CID 14544725
(6R,7S)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(3,4-dimethylpyridin-1-ium-1-yl)-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 14544725) has the molecular formula C21H22N6O5S and a molecular weight of 470.51 g/mol. Its IUPAC name is (6R,7S)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(3,4-dimethylpyridin-1-ium-1-yl)-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (6R,7S)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(3,4-dimethylpyridin-1-ium-1-yl)-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 14544725 |
| Molecular Formula | C21H22N6O5S |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | (6R,7S)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(3,4-dimethylpyridin-1-ium-1-yl)-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CO/N=C(\C(=O)N[C@@H]1C(=O)N2C(C(=O)[O-])=C([n+]3ccc(C)c(C)c3)CC[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C21H22N6O5S/c1-10-6-7-26(8-11(10)2)14-5-4-13-16(19(29)27(13)17(14)20(30)31)24-18(28)15(25-32-3)12-9-33-21(22)23-12/h6-9,13,16H,4-5H2,1-3H3,(H3-,22,23,24,28,30,31)/b25-15-/t13-,16+/m1/s1 |
| InChIKey | QIJCYZDPNHDONJ-ZYLYIYKGSA-N |
| XLogP | -0.91 |
| TPSA | 153.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|