C15H16N8O6S2 — CID 173326247
3-(2-amino-2-oxoethanehydrazonoyl)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 173326247) has the molecular formula C15H16N8O6S2 and a molecular weight of 468.48 g/mol. Its IUPAC name is 3-(2-amino-2-oxoethanehydrazonoyl)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | 3-(2-amino-2-oxoethanehydrazonoyl)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 173326247 |
| Molecular Formula | C15H16N8O6S2 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | 3-(2-amino-2-oxoethanehydrazonoyl)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(C(=NN)C(N)=O)SCC12)c1csc(N)n1 |
| InChI | InChI=1S/C15H16N8O6S2/c1-29-22-6(4-2-31-15(17)19-4)12(25)20-7-5-3-30-10(8(21-18)11(16)24)9(14(27)28)23(5)13(7)26/h2,5,7H,3,18H2,1H3,(H2,16,24)(H2,17,19)(H,20,25)(H,27,28) |
| InChIKey | BWTBABIFRGYSPM-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 228.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|