C20H18F3N5O8S2 — CID 139637907
(2,2,2-trifluoroacetyl) 7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(3-ethoxy-3-oxoprop-1-en-2-yl)-8-oxo-4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 139637907) has the molecular formula C20H18F3N5O8S2 and a molecular weight of 577.52 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(3-ethoxy-3-oxoprop-1-en-2-yl)-8-oxo-4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) 7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(3-ethoxy-3-oxoprop-1-en-2-yl)-8-oxo-4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 139637907 |
| Molecular Formula | C20H18F3N5O8S2 |
| Molecular Weight | 577.52 g/mol |
| Exact Mass | 577.05 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(3-ethoxy-3-oxoprop-1-en-2-yl)-8-oxo-4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | C=C(C(=O)OCC)C1=C(C(=O)OC(=O)C(F)(F)F)N2C(=O)C(NC(=O)/C(=N/OC)c3csc(N)n3)C2CS1 |
| InChI | InChI=1S/C20H18F3N5O8S2/c1-4-35-16(31)7(2)13-12(17(32)36-18(33)20(21,22)23)28-9(6-37-13)11(15(28)30)26-14(29)10(27-34-3)8-5-38-19(24)25-8/h5,9,11H,2,4,6H2,1,3H3,(H2,24,25)(H,26,29)/b27-10+ |
| InChIKey | ZFAWALSALADMQF-YPXUMCKCSA-N |
| XLogP | 0.48 |
| TPSA | 179.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.52 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|