C50H37NO — CID 145447273
[3-[(1E)-1-[(2E)-2-ethylidene-5-(4-triphenylen-2-ylphenyl)-1-benzofuran-3-ylidene]propyl]phenyl]-phenylmethanimine (PubChem CID 145447273) has the molecular formula C50H37NO and a molecular weight of 667.85 g/mol. Its IUPAC name is [3-[(1E)-1-[(2E)-2-ethylidene-5-(4-triphenylen-2-ylphenyl)-1-benzofuran-3-ylidene]propyl]phenyl]-phenylmethanimine.
| Compound Name | [3-[(1E)-1-[(2E)-2-ethylidene-5-(4-triphenylen-2-ylphenyl)-1-benzofuran-3-ylidene]propyl]phenyl]-phenylmethanimine |
|---|---|
| PubChem CID | 145447273 |
| Molecular Formula | C50H37NO |
| Molecular Weight | 667.85 g/mol |
| Exact Mass | 667.29 |
| IUPAC Name | [3-[(1E)-1-[(2E)-2-ethylidene-5-(4-triphenylen-2-ylphenyl)-1-benzofuran-3-ylidene]propyl]phenyl]-phenylmethanimine |
| SMILES | [H]/N=C(\c1ccccc1)c1cccc(/C(CC)=c2/c(=C\C)oc3ccc(-c4ccc(-c5ccc6c7ccccc7c7ccccc7c6c5)cc4)cc23)c1 |
| InChI | InChI=1S/C50H37NO/c1-3-39(37-15-12-16-38(29-37)50(51)34-13-6-5-7-14-34)49-46-31-36(26-28-48(46)52-47(49)4-2)33-23-21-32(22-24-33)35-25-27-44-42-19-9-8-17-40(42)41-18-10-11-20-43(41)45(44)30-35/h4-31,51H,3H2,1-2H3/b47-4+,49-39+,51-50+ |
| InChIKey | ZKGIJFUPBRSGSU-QUICDMMZSA-N |
| XLogP | 12.05 |
| TPSA | 36.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.85 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|