C47H37N3O — CID 145441666
dibenzofuran-3-amine;phenyl-[3-[3-[C-phenyl-N-[(Z)-1-phenylprop-1-enyl]carbonimidoyl]phenyl]phenyl]methanimine (PubChem CID 145441666) has the molecular formula C47H37N3O and a molecular weight of 659.83 g/mol. Its IUPAC name is dibenzofuran-3-amine;phenyl-[3-[3-[C-phenyl-N-[(Z)-1-phenylprop-1-enyl]carbonimidoyl]phenyl]phenyl]methanimine.
| Compound Name | dibenzofuran-3-amine;phenyl-[3-[3-[C-phenyl-N-[(Z)-1-phenylprop-1-enyl]carbonimidoyl]phenyl]phenyl]methanimine |
|---|---|
| PubChem CID | 145441666 |
| Molecular Formula | C47H37N3O |
| Molecular Weight | 659.83 g/mol |
| Exact Mass | 659.29 |
| IUPAC Name | dibenzofuran-3-amine;phenyl-[3-[3-[C-phenyl-N-[(Z)-1-phenylprop-1-enyl]carbonimidoyl]phenyl]phenyl]methanimine |
| SMILES | Nc1ccc2c(c1)oc1ccccc12.[H]/N=C(\c1ccccc1)c1cccc(-c2cccc(/C(=N/C(=C\C)c3ccccc3)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C35H28N2.C12H9NO/c1-2-33(26-14-6-3-7-15-26)37-35(28-18-10-5-11-19-28)32-23-13-21-30(25-32)29-20-12-22-31(24-29)34(36)27-16-8-4-9-17-27;13-8-5-6-10-9-3-1-2-4-11(9)14-12(10)7-8/h2-25,36H,1H3;1-7H,13H2/b33-2-,36-34+,37-35+; |
| InChIKey | URENLSWCQFITDF-JFGNJJONSA-N |
| XLogP | 11.84 |
| TPSA | 75.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.83 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|