C11H17NO — CID 145448927
(2E)-2-[(Z)-but-2-enylidene]-3-propan-2-ylidenemorpholine (PubChem CID 145448927) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (2E)-2-[(Z)-but-2-enylidene]-3-propan-2-ylidenemorpholine.
| Compound Name | (2E)-2-[(Z)-but-2-enylidene]-3-propan-2-ylidenemorpholine |
|---|---|
| PubChem CID | 145448927 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (2E)-2-[(Z)-but-2-enylidene]-3-propan-2-ylidenemorpholine |
| SMILES | C/C=C\C=C1\OCCNC1=C(C)C |
| InChI | InChI=1S/C11H17NO/c1-4-5-6-10-11(9(2)3)12-7-8-13-10/h4-6,12H,7-8H2,1-3H3/b5-4-,10-6+ |
| InChIKey | YHJIBQNFWQHPSR-VWJYOPCBSA-N |
| XLogP | 2.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |