C33H57NO4 — CID 145450865
5-ethyl-2,2,3,3,6,6,7-heptamethyloctane;4-[formyl(2-methylpentan-2-yl)carbamoyl]-3-methylbenzoic acid (PubChem CID 145450865) has the molecular formula C33H57NO4 and a molecular weight of 531.82 g/mol. Its IUPAC name is 5-ethyl-2,2,3,3,6,6,7-heptamethyloctane;4-[formyl(2-methylpentan-2-yl)carbamoyl]-3-methylbenzoic acid.
| Compound Name | 5-ethyl-2,2,3,3,6,6,7-heptamethyloctane;4-[formyl(2-methylpentan-2-yl)carbamoyl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 145450865 |
| Molecular Formula | C33H57NO4 |
| Molecular Weight | 531.82 g/mol |
| Exact Mass | 531.43 |
| IUPAC Name | 5-ethyl-2,2,3,3,6,6,7-heptamethyloctane;4-[formyl(2-methylpentan-2-yl)carbamoyl]-3-methylbenzoic acid |
| SMILES | CCC(CC(C)(C)C(C)(C)C)C(C)(C)C(C)C.CCCC(C)(C)N(C=O)C(=O)c1ccc(C(=O)O)cc1C |
| InChI | InChI=1S/C17H36.C16H21NO4/c1-11-14(17(9,10)13(2)3)12-16(7,8)15(4,5)6;1-5-8-16(3,4)17(10-18)14(19)13-7-6-12(15(20)21)9-11(13)2/h13-14H,11-12H2,1-10H3;6-7,9-10H,5,8H2,1-4H3,(H,20,21) |
| InChIKey | QBNOIZAPYGAMCQ-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.82 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|