C30H19CsN4O — CID 145451178
cesium 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]quinolin-8-olate (PubChem CID 145451178) has the molecular formula C30H19CsN4O and a molecular weight of 584.41 g/mol. Its IUPAC name is cesium 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]quinolin-8-olate.
| Compound Name | cesium 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]quinolin-8-olate |
|---|---|
| PubChem CID | 145451178 |
| Molecular Formula | C30H19CsN4O |
| Molecular Weight | 584.41 g/mol |
| Exact Mass | 584.06 |
| IUPAC Name | cesium 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]quinolin-8-olate |
| SMILES | [Cs+].[O-]c1cccc2ccc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)nc12 |
| InChI | InChI=1S/C30H20N4O.Cs/c35-26-16-8-13-20-17-18-25(31-27(20)26)23-14-7-15-24(19-23)30-33-28(21-9-3-1-4-10-21)32-29(34-30)22-11-5-2-6-12-22;/h1-19,35H;/q;+1/p-1 |
| InChIKey | KDYNLHRNKVDBFF-UHFFFAOYSA-M |
| XLogP | 3.17 |
| TPSA | 74.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |