C34H19F9N4O2S — CID 142621979
[1-[8-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]quinolin-2-yl]oxysulfanyl-1,1,2,3,3,4,4,4-octafluorobutan-2-yl] hypofluorite (PubChem CID 142621979) has the molecular formula C34H19F9N4O2S and a molecular weight of 718.60 g/mol. Its IUPAC name is [1-[8-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]quinolin-2-yl]oxysulfanyl-1,1,2,3,3,4,4,4-octafluorobutan-2-yl] hypofluorite.
| Compound Name | [1-[8-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]quinolin-2-yl]oxysulfanyl-1,1,2,3,3,4,4,4-octafluorobutan-2-yl] hypofluorite |
|---|---|
| PubChem CID | 142621979 |
| Molecular Formula | C34H19F9N4O2S |
| Molecular Weight | 718.60 g/mol |
| Exact Mass | 718.11 |
| IUPAC Name | [1-[8-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]quinolin-2-yl]oxysulfanyl-1,1,2,3,3,4,4,4-octafluorobutan-2-yl] hypofluorite |
| SMILES | FOC(F)(C(F)(F)SOc1ccc2cccc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)c2n1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C34H19F9N4O2S/c35-31(36,33(38,39)40)32(37,49-43)34(41,42)50-48-26-19-18-21-12-7-13-25(27(21)44-26)20-14-16-24(17-15-20)30-46-28(22-8-3-1-4-9-22)45-29(47-30)23-10-5-2-6-11-23/h1-19H |
| InChIKey | NKZFAIGQLMUBKM-UHFFFAOYSA-N |
| XLogP | 10.47 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.60 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|