C34H19F9N4OS — CID 142621904
3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfanyloxy)quinoline (PubChem CID 142621904) has the molecular formula C34H19F9N4OS and a molecular weight of 702.60 g/mol. Its IUPAC name is 3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfanyloxy)quinoline.
| Compound Name | 3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfanyloxy)quinoline |
|---|---|
| PubChem CID | 142621904 |
| Molecular Formula | C34H19F9N4OS |
| Molecular Weight | 702.60 g/mol |
| Exact Mass | 702.11 |
| IUPAC Name | 3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfanyloxy)quinoline |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)SOc1c(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2)cnc2ccccc12 |
| InChI | InChI=1S/C34H19F9N4OS/c35-31(36,33(39,40)41)32(37,38)34(42,43)49-48-27-24-13-7-8-14-26(24)44-19-25(27)20-15-17-23(18-16-20)30-46-28(21-9-3-1-4-10-21)45-29(47-30)22-11-5-2-6-12-22/h1-19H |
| InChIKey | YRIRGLXONIFKTL-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.60 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|