C28H35N5O — CID 145452142
1-methyl-5-[2-[4-(quinolin-5-ylmethoxymethylamino)cyclohexyl]ethyl]-6,7-dihydro-4H-pyrrolo[3,2-c]pyridine-2-carbonitrile (PubChem CID 145452142) has the molecular formula C28H35N5O and a molecular weight of 457.62 g/mol. Its IUPAC name is 1-methyl-5-[2-[4-(quinolin-5-ylmethoxymethylamino)cyclohexyl]ethyl]-6,7-dihydro-4H-pyrrolo[3,2-c]pyridine-2-carbonitrile.
| Compound Name | 1-methyl-5-[2-[4-(quinolin-5-ylmethoxymethylamino)cyclohexyl]ethyl]-6,7-dihydro-4H-pyrrolo[3,2-c]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 145452142 |
| Molecular Formula | C28H35N5O |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | 1-methyl-5-[2-[4-(quinolin-5-ylmethoxymethylamino)cyclohexyl]ethyl]-6,7-dihydro-4H-pyrrolo[3,2-c]pyridine-2-carbonitrile |
| SMILES | Cn1c(C#N)cc2c1CCN(CCC1CCC(NCOCc3cccc4ncccc34)CC1)C2 |
| InChI | InChI=1S/C28H35N5O/c1-32-25(17-29)16-23-18-33(15-12-28(23)32)14-11-21-7-9-24(10-8-21)31-20-34-19-22-4-2-6-27-26(22)5-3-13-30-27/h2-6,13,16,21,24,31H,7-12,14-15,18-20H2,1H3 |
| InChIKey | MXFVLFQFSSYTLK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 66.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|