C8H12N2OS — CID 145452178
methanamine;(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enal (PubChem CID 145452178) has the molecular formula C8H12N2OS and a molecular weight of 184.26 g/mol. Its IUPAC name is methanamine;(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enal.
| Compound Name | methanamine;(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enal |
|---|---|
| PubChem CID | 145452178 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | methanamine;(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enal |
| SMILES | CN.Cc1ncc(/C=C/C=O)s1 |
| InChI | InChI=1S/C7H7NOS.CH5N/c1-6-8-5-7(10-6)3-2-4-9;1-2/h2-5H,1H3;2H2,1H3/b3-2+; |
| InChIKey | PKLQWNLGYCLABI-SQQVDAMQSA-N |
| XLogP | 1.24 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|