C14H18ClN5O2 — CID 145452915
(E)-2-amino-3-chloro-4-imino-N-[6-[(2S)-morpholin-2-yl]-3-pyridinyl]pent-2-enamide (PubChem CID 145452915) has the molecular formula C14H18ClN5O2 and a molecular weight of 323.78 g/mol. Its IUPAC name is (E)-2-amino-3-chloro-4-imino-N-[6-[(2S)-morpholin-2-yl]-3-pyridinyl]pent-2-enamide.
| Compound Name | (E)-2-amino-3-chloro-4-imino-N-[6-[(2S)-morpholin-2-yl]-3-pyridinyl]pent-2-enamide |
|---|---|
| PubChem CID | 145452915 |
| Molecular Formula | C14H18ClN5O2 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | (E)-2-amino-3-chloro-4-imino-N-[6-[(2S)-morpholin-2-yl]-3-pyridinyl]pent-2-enamide |
| SMILES | [H]/N=C(C)/C(Cl)=C(\N)C(=O)Nc1ccc([C@@H]2CNCCO2)nc1 |
| InChI | InChI=1S/C14H18ClN5O2/c1-8(16)12(15)13(17)14(21)20-9-2-3-10(19-6-9)11-7-18-4-5-22-11/h2-3,6,11,16,18H,4-5,7,17H2,1H3,(H,20,21)/b13-12+,16-8+/t11-/m0/s1 |
| InChIKey | NUVWHYYXNQLFEM-IULXWZEGSA-N |
| XLogP | 1.13 |
| TPSA | 113.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|