C17H23ClN4O2 — CID 159725830
5-amino-4-chloro-3-imino-1-[6-[(2S)-morpholin-2-yl]-3-pyridinyl]oct-4-en-2-one (PubChem CID 159725830) has the molecular formula C17H23ClN4O2 and a molecular weight of 350.85 g/mol. Its IUPAC name is 5-amino-4-chloro-3-imino-1-[6-[(2S)-morpholin-2-yl]-3-pyridinyl]oct-4-en-2-one.
| Compound Name | 5-amino-4-chloro-3-imino-1-[6-[(2S)-morpholin-2-yl]-3-pyridinyl]oct-4-en-2-one |
|---|---|
| PubChem CID | 159725830 |
| Molecular Formula | C17H23ClN4O2 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 5-amino-4-chloro-3-imino-1-[6-[(2S)-morpholin-2-yl]-3-pyridinyl]oct-4-en-2-one |
| SMILES | [H]/N=C(/C(=O)Cc1ccc([C@@H]2CNCCO2)nc1)C(Cl)=C(N)CCC |
| InChI | InChI=1S/C17H23ClN4O2/c1-2-3-12(19)16(18)17(20)14(23)8-11-4-5-13(22-9-11)15-10-21-6-7-24-15/h4-5,9,15,20-21H,2-3,6-8,10,19H2,1H3/b16-12?,20-17-/t15-/m0/s1 |
| InChIKey | YRTMRWUXXALZSS-HMTPMTKISA-N |
| XLogP | 2.08 |
| TPSA | 101.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|