C16H19F3N2O2 — CID 145453094
tert-butyl (2R,3S)-4-methylidene-2-pyridin-3-yl-3-(trifluoromethyl)pyrrolidine-1-carboxylate (PubChem CID 145453094) has the molecular formula C16H19F3N2O2 and a molecular weight of 328.33 g/mol. Its IUPAC name is tert-butyl (2R,3S)-4-methylidene-2-pyridin-3-yl-3-(trifluoromethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S)-4-methylidene-2-pyridin-3-yl-3-(trifluoromethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 145453094 |
| Molecular Formula | C16H19F3N2O2 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | tert-butyl (2R,3S)-4-methylidene-2-pyridin-3-yl-3-(trifluoromethyl)pyrrolidine-1-carboxylate |
| SMILES | C=C1CN(C(=O)OC(C)(C)C)[C@@H](c2cccnc2)[C@H]1C(F)(F)F |
| InChI | InChI=1S/C16H19F3N2O2/c1-10-9-21(14(22)23-15(2,3)4)13(12(10)16(17,18)19)11-6-5-7-20-8-11/h5-8,12-13H,1,9H2,2-4H3/t12-,13-/m0/s1 |
| InChIKey | ICEVQIVXXAJNIJ-STQMWFEESA-N |
| XLogP | 4.11 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|