C14H25N3O6S — CID 145454795
(2S)-2-[[(2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-4-methylpentanoyl]amino]pentanedioic acid (PubChem CID 145454795) has the molecular formula C14H25N3O6S and a molecular weight of 363.44 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-4-methylpentanoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-4-methylpentanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 145454795 |
| Molecular Formula | C14H25N3O6S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-4-methylpentanoyl]amino]pentanedioic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)CS)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H25N3O6S/c1-7(2)5-10(17-12(20)8(15)6-24)13(21)16-9(14(22)23)3-4-11(18)19/h7-10,24H,3-6,15H2,1-2H3,(H,16,21)(H,17,20)(H,18,19)(H,22,23)/t8-,9-,10-/m0/s1 |
| InChIKey | XLLSMEFANRROJE-GUBZILKMSA-N |
| XLogP | -0.79 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|