C22H29N10O7P — CID 145459108
[(1R,2S,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-hydroxycyclopentyl]methyl [(1S,2R,4R)-4-(6-aminopurin-9-yl)-2-(hydroxymethyl)cyclopentyl] hydrogen phosphate (PubChem CID 145459108) has the molecular formula C22H29N10O7P and a molecular weight of 576.51 g/mol. Its IUPAC name is [(1R,2S,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-hydroxycyclopentyl]methyl [(1S,2R,4R)-4-(6-aminopurin-9-yl)-2-(hydroxymethyl)cyclopentyl] hydrogen phosphate.
| Compound Name | [(1R,2S,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-hydroxycyclopentyl]methyl [(1S,2R,4R)-4-(6-aminopurin-9-yl)-2-(hydroxymethyl)cyclopentyl] hydrogen phosphate |
|---|---|
| PubChem CID | 145459108 |
| Molecular Formula | C22H29N10O7P |
| Molecular Weight | 576.51 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | [(1R,2S,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-hydroxycyclopentyl]methyl [(1S,2R,4R)-4-(6-aminopurin-9-yl)-2-(hydroxymethyl)cyclopentyl] hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2[C@@H]2C[C@H](COP(=O)(O)O[C@H]3C[C@H](n4cnc5c(N)ncnc54)C[C@@H]3CO)[C@@H](O)C2)c(=O)[nH]1 |
| InChI | InChI=1S/C22H29N10O7P/c23-18-16-19(26-7-25-18)31(8-27-16)13-1-10(5-33)15(4-13)39-40(36,37)38-6-11-2-12(3-14(11)34)32-9-28-17-20(32)29-22(24)30-21(17)35/h7-15,33-34H,1-6H2,(H,36,37)(H2,23,25,26)(H3,24,29,30,35)/t10-,11-,12-,13-,14+,15+/m1/s1 |
| InChIKey | HXYJEJHYBXAMEP-MBIARJLFSA-N |
| XLogP | -0.12 |
| TPSA | 255.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.51 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|