C10H14N2O — CID 145459185
(Z)-4-cyclohexa-1,5-dien-1-yl-4-iminobut-2-enamide;molecular hydrogen (PubChem CID 145459185) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is (Z)-4-cyclohexa-1,5-dien-1-yl-4-iminobut-2-enamide;molecular hydrogen.
| Compound Name | (Z)-4-cyclohexa-1,5-dien-1-yl-4-iminobut-2-enamide;molecular hydrogen |
|---|---|
| PubChem CID | 145459185 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | (Z)-4-cyclohexa-1,5-dien-1-yl-4-iminobut-2-enamide;molecular hydrogen |
| SMILES | [H]/N=C(/C=C\C(N)=O)C1=CCCC=C1.[H][H] |
| InChI | InChI=1S/C10H12N2O.H2/c11-9(6-7-10(12)13)8-4-2-1-3-5-8;/h2,4-7,11H,1,3H2,(H2,12,13);1H/b7-6-,11-9-; |
| InChIKey | MGEBXULYVTYGKM-CWZDAQKXSA-N |
| XLogP | 1.57 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|