C8H10N2O — CID 22716504
2-(4-iminocyclohexa-1,5-dien-1-yl)acetamide (PubChem CID 22716504) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is 2-(4-iminocyclohexa-1,5-dien-1-yl)acetamide.
| Compound Name | 2-(4-iminocyclohexa-1,5-dien-1-yl)acetamide |
|---|---|
| PubChem CID | 22716504 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 2-(4-iminocyclohexa-1,5-dien-1-yl)acetamide |
| SMILES | [H]/N=C1/C=CC(CC(N)=O)=CC1 |
| InChI | InChI=1S/C8H10N2O/c9-7-3-1-6(2-4-7)5-8(10)11/h1-3,9H,4-5H2,(H2,10,11)/b9-7- |
| InChIKey | RTTHUUUDEYCWIW-CLFYSBASSA-N |
| XLogP | 0.77 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|