C9H11N3O — CID 143438356
(4E)-4-ethenyl-2,3-diiminohepta-4,6-dienamide (PubChem CID 143438356) has the molecular formula C9H11N3O and a molecular weight of 177.21 g/mol. Its IUPAC name is (4E)-4-ethenyl-2,3-diiminohepta-4,6-dienamide.
| Compound Name | (4E)-4-ethenyl-2,3-diiminohepta-4,6-dienamide |
|---|---|
| PubChem CID | 143438356 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | (4E)-4-ethenyl-2,3-diiminohepta-4,6-dienamide |
| SMILES | [H]/N=C(C(N)=O)/C(=N\[H])C(/C=C)=C/C=C |
| InChI | InChI=1S/C9H11N3O/c1-3-5-6(4-2)7(10)8(11)9(12)13/h3-5,10-11H,1-2H2,(H2,12,13)/b6-5+,10-7-,11-8- |
| InChIKey | GWNVDSWFSXYJHL-FQJAJJDVSA-N |
| XLogP | 0.81 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|