C10H16N2O — CID 123809337
(2E)-2-propanimidoylhepta-2,4-dienamide (PubChem CID 123809337) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is (2E)-2-propanimidoylhepta-2,4-dienamide.
| Compound Name | (2E)-2-propanimidoylhepta-2,4-dienamide |
|---|---|
| PubChem CID | 123809337 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | (2E)-2-propanimidoylhepta-2,4-dienamide |
| SMILES | [H]/N=C(CC)/C(=C\C=CCC)C(N)=O |
| InChI | InChI=1S/C10H16N2O/c1-3-5-6-7-8(10(12)13)9(11)4-2/h5-7,11H,3-4H2,1-2H3,(H2,12,13)/b6-5?,8-7+,11-9+ |
| InChIKey | OTENZXHSTCIIEJ-WVLBEONNSA-N |
| XLogP | 1.79 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|