C7H7N3O — CID 88799550
6-diazocyclohexa-1,3-diene-1-carboxamide (PubChem CID 88799550) has the molecular formula C7H7N3O and a molecular weight of 149.15 g/mol. Its IUPAC name is 6-diazocyclohexa-1,3-diene-1-carboxamide.
| Compound Name | 6-diazocyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 88799550 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 6-diazocyclohexa-1,3-diene-1-carboxamide |
| SMILES | [N-]=[N+]=C1CC=CC=C1C(N)=O |
| InChI | InChI=1S/C7H7N3O/c8-7(11)5-3-1-2-4-6(5)10-9/h1-3H,4H2,(H2,8,11) |
| InChIKey | BZWNTXRSSYAPOA-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|