About 6-bromo-8H-1,2,3-benzotriazin-4-one
6-bromo-8H-1,2,3-benzotriazin-4-one (PubChem CID 57012449) has the molecular formula C7H4BrN3O
and a molecular weight of 226.03 g/mol. Its IUPAC name is 6-bromo-8H-1,2,3-benzotriazin-4-one.
Molecular Properties
| Compound Name | 6-bromo-8H-1,2,3-benzotriazin-4-one |
| PubChem CID | 57012449 |
| Molecular Formula | C7H4BrN3O |
| Molecular Weight | 226.03 g/mol |
| Exact Mass | 224.95 |
| IUPAC Name | 6-bromo-8H-1,2,3-benzotriazin-4-one |
| SMILES | O=C1N=NN=C2CC=C(Br)C=C12 |
| InChI | InChI=1S/C7H4BrN3O/c8-4-1-2-6-5(3-4)7(12)10-11-9-6/h1,3H,2H2 |
| InChIKey | YCOQIWRPKWYXFB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 54.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.03 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-8H-1,2,3-benzotriazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-8H-1,2,3-benzotriazin-4-one?
The IUPAC name of 6-bromo-8H-1,2,3-benzotriazin-4-one (CID 57012449) is 6-bromo-8H-1,2,3-benzotriazin-4-one.
What is the SMILES notation for 6-bromo-8H-1,2,3-benzotriazin-4-one?
The canonical SMILES for 6-bromo-8H-1,2,3-benzotriazin-4-one is O=C1N=NN=C2CC=C(Br)C=C12.
What is the InChIKey of 6-bromo-8H-1,2,3-benzotriazin-4-one?
The InChIKey is YCOQIWRPKWYXFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrN3O/c8-4-1-2-6-5(3-4)7(12)10-11-9-6/h1,3H,2H2.
What are the key properties of 6-bromo-8H-1,2,3-benzotriazin-4-one?
6-bromo-8H-1,2,3-benzotriazin-4-one has a molecular weight of 226.03 g/mol, XLogP of 1.94, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-8H-1,2,3-benzotriazin-4-one is sourced from PubChem (CID 57012449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).