About (6Z)-5-iminonona-6,8-dienamide
(6Z)-5-iminonona-6,8-dienamide (PubChem CID 143198423) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is (6Z)-5-iminonona-6,8-dienamide.
Molecular Properties
| Compound Name | (6Z)-5-iminonona-6,8-dienamide |
| PubChem CID | 143198423 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | (6Z)-5-iminonona-6,8-dienamide |
| SMILES | [H]/N=C(/C=C\C=C)CCCC(N)=O |
| InChI | InChI=1S/C9H14N2O/c1-2-3-5-8(10)6-4-7-9(11)12/h2-3,5,10H,1,4,6-7H2,(H2,11,12)/b5-3-,10-8- |
| InChIKey | SXXFDHMHGDJIMN-PGNVZPTMSA-N |
| XLogP | 1.40 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (6Z)-5-iminonona-6,8-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-5-iminonona-6,8-dienamide?
The IUPAC name of (6Z)-5-iminonona-6,8-dienamide (CID 143198423) is (6Z)-5-iminonona-6,8-dienamide.
What is the SMILES notation for (6Z)-5-iminonona-6,8-dienamide?
The canonical SMILES for (6Z)-5-iminonona-6,8-dienamide is [H]/N=C(/C=C\C=C)CCCC(N)=O.
What is the InChIKey of (6Z)-5-iminonona-6,8-dienamide?
The InChIKey is SXXFDHMHGDJIMN-PGNVZPTMSA-N. The full InChI is InChI=1S/C9H14N2O/c1-2-3-5-8(10)6-4-7-9(11)12/h2-3,5,10H,1,4,6-7H2,(H2,11,12)/b5-3-,10-8-.
What are the key properties of (6Z)-5-iminonona-6,8-dienamide?
(6Z)-5-iminonona-6,8-dienamide has a molecular weight of 166.22 g/mol, XLogP of 1.40, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-5-iminonona-6,8-dienamide is sourced from PubChem (CID 143198423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).