C10H14N2O — CID 90949307
4-cyclohexa-1,3-dien-1-yl-4-iminobutanamide (PubChem CID 90949307) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 4-cyclohexa-1,3-dien-1-yl-4-iminobutanamide.
| Compound Name | 4-cyclohexa-1,3-dien-1-yl-4-iminobutanamide |
|---|---|
| PubChem CID | 90949307 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 4-cyclohexa-1,3-dien-1-yl-4-iminobutanamide |
| SMILES | [H]/N=C(\CCC(N)=O)C1=CC=CCC1 |
| InChI | InChI=1S/C10H14N2O/c11-9(6-7-10(12)13)8-4-2-1-3-5-8/h1-2,4,11H,3,5-7H2,(H2,12,13)/b11-9+ |
| InChIKey | ICLYPZMEPXEWBL-PKNBQFBNSA-N |
| XLogP | 1.55 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|