About (2S)-5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide;uranium
(2S)-5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide;uranium (PubChem CID 155709968) has the molecular formula C11H11N2OU-
and a molecular weight of 425.25 g/mol. Its IUPAC name is (2S)-5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide;uranium.
Molecular Properties
| Compound Name | (2S)-5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide;uranium |
| PubChem CID | 155709968 |
| Molecular Formula | C11H11N2OU- |
| Molecular Weight | 425.25 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | (2S)-5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide;uranium |
| SMILES | NC(=O)[C@@H]1CCC(c2cc[c-]cc2)=N1.[U] |
| InChI | InChI=1S/C11H11N2O.U/c12-11(14)10-7-6-9(13-10)8-4-2-1-3-5-8;/h2-5,10H,6-7H2,(H2,12,14);/q-1;/t10-;/m0./s1 |
| InChIKey | UXCQLGSZWVJYIB-PPHPATTJSA-N |
| XLogP | 0.92 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (2S)-5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide;uranium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide;uranium?
The IUPAC name of (2S)-5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide;uranium (CID 155709968) is (2S)-5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide;uranium.
What is the SMILES notation for (2S)-5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide;uranium?
The canonical SMILES for (2S)-5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide;uranium is NC(=O)[C@@H]1CCC(c2cc[c-]cc2)=N1.[U].
What is the InChIKey of (2S)-5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide;uranium?
The InChIKey is UXCQLGSZWVJYIB-PPHPATTJSA-N. The full InChI is InChI=1S/C11H11N2O.U/c12-11(14)10-7-6-9(13-10)8-4-2-1-3-5-8;/h2-5,10H,6-7H2,(H2,12,14);/q-1;/t10-;/m0./s1.
What are the key properties of (2S)-5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide;uranium?
(2S)-5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide;uranium has a molecular weight of 425.25 g/mol, XLogP of 0.92, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide;uranium is sourced from PubChem (CID 155709968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).