About potassium 5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide
potassium 5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide (PubChem CID 155709979) has the molecular formula C11H11KN2O
and a molecular weight of 226.32 g/mol. Its IUPAC name is potassium 5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | potassium 5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide |
| PubChem CID | 155709979 |
| Molecular Formula | C11H11KN2O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | potassium 5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide |
| SMILES | NC(=O)C1CCC(c2cc[c-]cc2)=N1.[K+] |
| InChI | InChI=1S/C11H11N2O.K/c12-11(14)10-7-6-9(13-10)8-4-2-1-3-5-8;/h2-5,10H,6-7H2,(H2,12,14);/q-1;+1 |
| InChIKey | DKBJXIASRCVVDN-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium 5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide?
The IUPAC name of potassium 5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide (CID 155709979) is potassium 5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide.
What is the SMILES notation for potassium 5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide?
The canonical SMILES for potassium 5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide is NC(=O)C1CCC(c2cc[c-]cc2)=N1.[K+].
What is the InChIKey of potassium 5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide?
The InChIKey is DKBJXIASRCVVDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N2O.K/c12-11(14)10-7-6-9(13-10)8-4-2-1-3-5-8;/h2-5,10H,6-7H2,(H2,12,14);/q-1;+1.
What are the key properties of potassium 5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide?
potassium 5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide has a molecular weight of 226.32 g/mol, XLogP of -2.07, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 5-phenyl-3,4-dihydro-2H-pyrrole-2-carboxamide is sourced from PubChem (CID 155709979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).