C13H18N2O2 — CID 169248895
(4Z)-2-propanoylimino-4-[(Z)-prop-1-enyl]hepta-4,6-dienamide (PubChem CID 169248895) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is (4Z)-2-propanoylimino-4-[(Z)-prop-1-enyl]hepta-4,6-dienamide.
| Compound Name | (4Z)-2-propanoylimino-4-[(Z)-prop-1-enyl]hepta-4,6-dienamide |
|---|---|
| PubChem CID | 169248895 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (4Z)-2-propanoylimino-4-[(Z)-prop-1-enyl]hepta-4,6-dienamide |
| SMILES | C=C/C=C(\C=C/C)C/C(=N/C(=O)CC)C(N)=O |
| InChI | InChI=1S/C13H18N2O2/c1-4-7-10(8-5-2)9-11(13(14)17)15-12(16)6-3/h4-5,7-8H,1,6,9H2,2-3H3,(H2,14,17)/b8-5-,10-7+,15-11- |
| InChIKey | XUDQWMCLTYXSCT-MYGKCSRISA-N |
| XLogP | 1.93 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|