C8H8N2O — CID 143410299
2-(3,4-diiminocyclohexa-1,5-dien-1-yl)acetaldehyde (PubChem CID 143410299) has the molecular formula C8H8N2O and a molecular weight of 148.17 g/mol. Its IUPAC name is 2-(3,4-diiminocyclohexa-1,5-dien-1-yl)acetaldehyde.
| Compound Name | 2-(3,4-diiminocyclohexa-1,5-dien-1-yl)acetaldehyde |
|---|---|
| PubChem CID | 143410299 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 2-(3,4-diiminocyclohexa-1,5-dien-1-yl)acetaldehyde |
| SMILES | [H]/N=C1\C=CC(CC=O)=C\C1=N/[H] |
| InChI | InChI=1S/C8H8N2O/c9-7-2-1-6(3-4-11)5-8(7)10/h1-2,4-5,9-10H,3H2/b9-7+,10-8+ |
| InChIKey | RKTXAAGPPRGZAJ-FIFLTTCUSA-N |
| XLogP | 1.11 |
| TPSA | 64.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|