C7H8N2OS — CID 159345397
5,6-diiminocyclohexa-1,3-diene-1-carbaldehyde;sulfane (PubChem CID 159345397) has the molecular formula C7H8N2OS and a molecular weight of 168.22 g/mol. Its IUPAC name is 5,6-diiminocyclohexa-1,3-diene-1-carbaldehyde;sulfane.
| Compound Name | 5,6-diiminocyclohexa-1,3-diene-1-carbaldehyde;sulfane |
|---|---|
| PubChem CID | 159345397 |
| Molecular Formula | C7H8N2OS |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 5,6-diiminocyclohexa-1,3-diene-1-carbaldehyde;sulfane |
| SMILES | S.[H]/N=C1/C(C=O)=CC=C/C1=N\[H] |
| InChI | InChI=1S/C7H6N2O.H2S/c8-6-3-1-2-5(4-10)7(6)9;/h1-4,8-9H;1H2/b8-6+,9-7-; |
| InChIKey | LGQVPCIJQAETHL-ULCBHPGJSA-N |
| XLogP | 0.83 |
| TPSA | 64.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|