C7H7NO — CID 151352510
4-iminocyclohexa-1,5-diene-1-carbaldehyde (PubChem CID 151352510) has the molecular formula C7H7NO and a molecular weight of 121.14 g/mol. Its IUPAC name is 4-iminocyclohexa-1,5-diene-1-carbaldehyde.
| Compound Name | 4-iminocyclohexa-1,5-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 151352510 |
| Molecular Formula | C7H7NO |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.05 |
| IUPAC Name | 4-iminocyclohexa-1,5-diene-1-carbaldehyde |
| SMILES | [H]/N=C1/C=CC(C=O)=CC1 |
| InChI | InChI=1S/C7H7NO/c8-7-3-1-6(5-9)2-4-7/h1-3,5,8H,4H2/b8-7- |
| InChIKey | OMTVDSYJXOWDSH-FPLPWBNLSA-N |
| XLogP | 1.09 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|