C15H19NO — CID 123708822
(3Z)-7-ethanimidoyl-8-methyl-2,5,6-trimethylidenenona-3,7-dienal (PubChem CID 123708822) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is (3Z)-7-ethanimidoyl-8-methyl-2,5,6-trimethylidenenona-3,7-dienal.
| Compound Name | (3Z)-7-ethanimidoyl-8-methyl-2,5,6-trimethylidenenona-3,7-dienal |
|---|---|
| PubChem CID | 123708822 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | (3Z)-7-ethanimidoyl-8-methyl-2,5,6-trimethylidenenona-3,7-dienal |
| SMILES | [H]/N=C(\C)C(C(=C)C(=C)/C=C\C(=C)C=O)=C(C)C |
| InChI | InChI=1S/C15H19NO/c1-10(2)15(14(6)16)13(5)12(4)8-7-11(3)9-17/h7-9,16H,3-5H2,1-2,6H3/b8-7-,16-14+ |
| InChIKey | LBVUYMOWBQHUNN-VDQOBTTFSA-N |
| XLogP | 3.79 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|