C19H37NO — CID 142806084
ethane;(2E,4E,5Z)-5-ethanimidoyl-2-ethyl-4-ethylidenehepta-2,5-dienal (PubChem CID 142806084) has the molecular formula C19H37NO and a molecular weight of 295.51 g/mol. Its IUPAC name is ethane;(2E,4E,5Z)-5-ethanimidoyl-2-ethyl-4-ethylidenehepta-2,5-dienal.
| Compound Name | ethane;(2E,4E,5Z)-5-ethanimidoyl-2-ethyl-4-ethylidenehepta-2,5-dienal |
|---|---|
| PubChem CID | 142806084 |
| Molecular Formula | C19H37NO |
| Molecular Weight | 295.51 g/mol |
| Exact Mass | 295.29 |
| IUPAC Name | ethane;(2E,4E,5Z)-5-ethanimidoyl-2-ethyl-4-ethylidenehepta-2,5-dienal |
| SMILES | CC.CC.CC.[H]/N=C(C)/C(=C\C)C(/C=C(/C=O)CC)=C/C |
| InChI | InChI=1S/C13H19NO.3C2H6/c1-5-11(9-15)8-12(6-2)13(7-3)10(4)14;3*1-2/h6-9,14H,5H2,1-4H3;3*1-2H3/b11-8+,12-6+,13-7+,14-10+;;; |
| InChIKey | ZHCYKQHJOHJEIO-LGODLQFKSA-N |
| XLogP | 6.53 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.51 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|