C9H9NO — CID 145451637
(6Z)-6-ethylidene-5-iminocyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 145451637) has the molecular formula C9H9NO and a molecular weight of 147.18 g/mol. Its IUPAC name is (6Z)-6-ethylidene-5-iminocyclohexa-1,3-diene-1-carbaldehyde.
| Compound Name | (6Z)-6-ethylidene-5-iminocyclohexa-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 145451637 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | (6Z)-6-ethylidene-5-iminocyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | [H]/N=C1\C=CC=C(C=O)\C1=C\C |
| InChI | InChI=1S/C9H9NO/c1-2-8-7(6-11)4-3-5-9(8)10/h2-6,10H,1H3/b8-2-,10-9+ |
| InChIKey | CLIGNQQLOJUEEB-CZOJQTGXSA-N |
| XLogP | 1.65 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|