C9H11NO — CID 91018660
7-imino-3-methylcyclohepta-1,5-diene-1-carbaldehyde (PubChem CID 91018660) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is 7-imino-3-methylcyclohepta-1,5-diene-1-carbaldehyde.
| Compound Name | 7-imino-3-methylcyclohepta-1,5-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 91018660 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 7-imino-3-methylcyclohepta-1,5-diene-1-carbaldehyde |
| SMILES | [H]/N=C1\C=CCC(C)C=C1C=O |
| InChI | InChI=1S/C9H11NO/c1-7-3-2-4-9(10)8(5-7)6-11/h2,4-7,10H,3H2,1H3/b10-9+ |
| InChIKey | HRXVJISSJMKMKH-MDZDMXLPSA-N |
| XLogP | 1.73 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|