C13H17NO — CID 144947772
(3E,5E,8Z)-6-ethenyl-7-imino-3-methyldeca-3,5,8-trienal (PubChem CID 144947772) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is (3E,5E,8Z)-6-ethenyl-7-imino-3-methyldeca-3,5,8-trienal.
| Compound Name | (3E,5E,8Z)-6-ethenyl-7-imino-3-methyldeca-3,5,8-trienal |
|---|---|
| PubChem CID | 144947772 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (3E,5E,8Z)-6-ethenyl-7-imino-3-methyldeca-3,5,8-trienal |
| SMILES | [H]N=C(/C=C\C)/C(C=C)=C/C=C(\C)CC=O |
| InChI | InChI=1S/C13H17NO/c1-4-6-13(14)12(5-2)8-7-11(3)9-10-15/h4-8,10,14H,2,9H2,1,3H3/b6-4-,11-7+,12-8+,14-13+ |
| InChIKey | MQNZKJHHLHQWGA-GLPPIJBQSA-N |
| XLogP | 3.23 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|