C12H18N2O — CID 163692159
(3E,5Z)-2-imino-5-(2-propyliminoethyl)hepta-3,5-dienal (PubChem CID 163692159) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is (3E,5Z)-2-imino-5-(2-propyliminoethyl)hepta-3,5-dienal.
| Compound Name | (3E,5Z)-2-imino-5-(2-propyliminoethyl)hepta-3,5-dienal |
|---|---|
| PubChem CID | 163692159 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | (3E,5Z)-2-imino-5-(2-propyliminoethyl)hepta-3,5-dienal |
| SMILES | [H]/N=C(C=O)/C=C/C(=C\C)C/C=N/CCC |
| InChI | InChI=1S/C12H18N2O/c1-3-8-14-9-7-11(4-2)5-6-12(13)10-15/h4-6,9-10,13H,3,7-8H2,1-2H3/b6-5+,11-4+,13-12-,14-9+ |
| InChIKey | JTWSRGFIVAXWHT-HCCDKPQGSA-N |
| XLogP | 2.58 |
| TPSA | 53.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|