C20H26N2O — CID 144533576
(4Z,8Z,11Z)-12-amino-11-methyl-3,6,7,10-tetramethylidene-13-methyliminotetradeca-4,8,11-trienal (PubChem CID 144533576) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is (4Z,8Z,11Z)-12-amino-11-methyl-3,6,7,10-tetramethylidene-13-methyliminotetradeca-4,8,11-trienal.
| Compound Name | (4Z,8Z,11Z)-12-amino-11-methyl-3,6,7,10-tetramethylidene-13-methyliminotetradeca-4,8,11-trienal |
|---|---|
| PubChem CID | 144533576 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | (4Z,8Z,11Z)-12-amino-11-methyl-3,6,7,10-tetramethylidene-13-methyliminotetradeca-4,8,11-trienal |
| SMILES | C=C(/C=C\C(=C)C(=C)/C=C\C(=C)/C(C)=C(N)/C(C)=N/C)CC=O |
| InChI | InChI=1S/C20H26N2O/c1-14(12-13-23)8-9-15(2)16(3)10-11-17(4)18(5)20(21)19(6)22-7/h8-11,13H,1-4,12,21H2,5-7H3/b9-8-,11-10-,20-18-,22-19+ |
| InChIKey | ZASADDDMISKGHD-YUFAMTQGSA-N |
| XLogP | 4.24 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|