C15H23NO — CID 144947771
ethane;(3E,5E,8Z)-6-ethenyl-7-imino-3-methyldeca-3,5,8-trienal (PubChem CID 144947771) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is ethane;(3E,5E,8Z)-6-ethenyl-7-imino-3-methyldeca-3,5,8-trienal.
| Compound Name | ethane;(3E,5E,8Z)-6-ethenyl-7-imino-3-methyldeca-3,5,8-trienal |
|---|---|
| PubChem CID | 144947771 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | ethane;(3E,5E,8Z)-6-ethenyl-7-imino-3-methyldeca-3,5,8-trienal |
| SMILES | CC.[H]N=C(C=CC)/C(C=C)=C/C=C(\C)CC=O |
| InChI | InChI=1S/C13H17NO.C2H6/c1-4-6-13(14)12(5-2)8-7-11(3)9-10-15;1-2/h4-8,10,14H,2,9H2,1,3H3;1-2H3/b6-4-,11-7+,12-8+,14-13+; |
| InChIKey | PHVBMUSFLQANSX-MCERZFRCSA-N |
| XLogP | 4.26 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|