C12H18N2O — CID 142046945
(4Z,5E,7Z)-4-hydrazinylidene-3-propan-2-ylidenenona-5,7-dienal (PubChem CID 142046945) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is (4Z,5E,7Z)-4-hydrazinylidene-3-propan-2-ylidenenona-5,7-dienal.
| Compound Name | (4Z,5E,7Z)-4-hydrazinylidene-3-propan-2-ylidenenona-5,7-dienal |
|---|---|
| PubChem CID | 142046945 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | (4Z,5E,7Z)-4-hydrazinylidene-3-propan-2-ylidenenona-5,7-dienal |
| SMILES | C/C=C\C=C\C(=N\N)C(CC=O)=C(C)C |
| InChI | InChI=1S/C12H18N2O/c1-4-5-6-7-12(14-13)11(8-9-15)10(2)3/h4-7,9H,8,13H2,1-3H3/b5-4-,7-6+,14-12- |
| InChIKey | AYPGCZYIZMYNJO-SWNAKAFASA-N |
| XLogP | 2.36 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|