C8H10N2O — CID 143189898
(3E)-4-methanimidoyl-2-methyliminohexa-3,5-dienal (PubChem CID 143189898) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is (3E)-4-methanimidoyl-2-methyliminohexa-3,5-dienal.
| Compound Name | (3E)-4-methanimidoyl-2-methyliminohexa-3,5-dienal |
|---|---|
| PubChem CID | 143189898 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | (3E)-4-methanimidoyl-2-methyliminohexa-3,5-dienal |
| SMILES | [H]/N=C/C(C=C)=C/C(C=O)=N/C |
| InChI | InChI=1S/C8H10N2O/c1-3-7(5-9)4-8(6-11)10-2/h3-6,9H,1H2,2H3/b7-4+,9-5+,10-8- |
| InChIKey | LGMZRERXCOZZDJ-DYOHBZSRSA-N |
| XLogP | 1.02 |
| TPSA | 53.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|