C8H11NO — CID 143141318
(3Z)-2-ethyliminohexa-3,5-dienal (PubChem CID 143141318) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is (3Z)-2-ethyliminohexa-3,5-dienal.
| Compound Name | (3Z)-2-ethyliminohexa-3,5-dienal |
|---|---|
| PubChem CID | 143141318 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | (3Z)-2-ethyliminohexa-3,5-dienal |
| SMILES | C=C/C=C\C(C=O)=N\CC |
| InChI | InChI=1S/C8H11NO/c1-3-5-6-8(7-10)9-4-2/h3,5-7H,1,4H2,2H3/b6-5-,9-8- |
| InChIKey | IYXNXIMNDIWDDS-AFJQJTPPSA-N |
| XLogP | 1.39 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|