C8H8F3NO — CID 153396831
(3E)-2-methylimino-4-(trifluoromethyl)hexa-3,5-dienal (PubChem CID 153396831) has the molecular formula C8H8F3NO and a molecular weight of 191.15 g/mol. Its IUPAC name is (3E)-2-methylimino-4-(trifluoromethyl)hexa-3,5-dienal.
| Compound Name | (3E)-2-methylimino-4-(trifluoromethyl)hexa-3,5-dienal |
|---|---|
| PubChem CID | 153396831 |
| Molecular Formula | C8H8F3NO |
| Molecular Weight | 191.15 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | (3E)-2-methylimino-4-(trifluoromethyl)hexa-3,5-dienal |
| SMILES | C=C/C(=C\C(C=O)=N\C)C(F)(F)F |
| InChI | InChI=1S/C8H8F3NO/c1-3-6(8(9,10)11)4-7(5-13)12-2/h3-5H,1H2,2H3/b6-4+,12-7- |
| InChIKey | FAZYXLFWGUBBBR-SVXSPUGDSA-N |
| XLogP | 1.93 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.15 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|